C11H12FN3O3 — CID 24761182
azanium 3-[(4-fluorophenyl)methyl]-2,6-dioxopyrimidin-4-olate (PubChem CID 24761182) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is azanium 3-[(4-fluorophenyl)methyl]-2,6-dioxopyrimidin-4-olate.
| Compound Name | azanium 3-[(4-fluorophenyl)methyl]-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 24761182 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | azanium 3-[(4-fluorophenyl)methyl]-2,6-dioxopyrimidin-4-olate |
| SMILES | O=c1cc([O-])n(Cc2ccc(F)cc2)c(=O)[nH]1.[NH4+] |
| InChI | InChI=1S/C11H9FN2O3.H3N/c12-8-3-1-7(2-4-8)6-14-10(16)5-9(15)13-11(14)17;/h1-5,16H,6H2,(H,13,15,17);1H3 |
| InChIKey | IRJSLNSBERAFFS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |