About 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride
4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride (PubChem CID 24761188) has the molecular formula C16H12ClN3O2
and a molecular weight of 313.74 g/mol. Its IUPAC name is 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride |
| PubChem CID | 24761188 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(Nc2ncnc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C16H11N3O2.ClH/c20-11-7-5-10(6-8-11)19-16-15-14(17-9-18-16)12-3-1-2-4-13(12)21-15;/h1-9,20H,(H,17,18,19);1H |
| InChIKey | FABUBHYRWJUMHH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride?
The IUPAC name of 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride (CID 24761188) is 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride.
What is the SMILES notation for 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride?
The canonical SMILES for 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride is Cl.Oc1ccc(Nc2ncnc3c2oc2ccccc23)cc1.
What is the InChIKey of 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride?
The InChIKey is FABUBHYRWJUMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O2.ClH/c20-11-7-5-10(6-8-11)19-16-15-14(17-9-18-16)12-3-1-2-4-13(12)21-15;/h1-9,20H,(H,17,18,19);1H.
What are the key properties of 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride?
4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride has a molecular weight of 313.74 g/mol, XLogP of 4.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)phenol;hydrochloride is sourced from PubChem (CID 24761188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).