C23H38N2O6 — CID 24761199
(3aR,8aR,9aR)-3-[[2-(diethylamino)ethylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one;oxalic acid (PubChem CID 24761199) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is (3aR,8aR,9aR)-3-[[2-(diethylamino)ethylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one;oxalic acid.
| Compound Name | (3aR,8aR,9aR)-3-[[2-(diethylamino)ethylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one;oxalic acid |
|---|---|
| PubChem CID | 24761199 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (3aR,8aR,9aR)-3-[[2-(diethylamino)ethylamino]methyl]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one;oxalic acid |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)C(CNCCN(CC)CC)[C@H]3CC12.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H36N2O2.C2H2O4/c1-5-23(6-2)11-10-22-14-17-16-12-18-15(3)8-7-9-21(18,4)13-19(16)25-20(17)24;3-1(4)2(5)6/h16-19,22H,3,5-14H2,1-2,4H3;(H,3,4)(H,5,6)/t16-,17?,18?,19-,21-;/m1./s1 |
| InChIKey | DLFYXXSTGNZUQC-TVLCZOPXSA-N |
| XLogP | 2.39 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|