C19H19N3O4 — CID 24761229
5-methyl-4-[2-(1-methylimidazol-2-yl)ethynyl]-3-(3,4,5-trimethoxyphenyl)-1,2-oxazole (PubChem CID 24761229) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-methyl-4-[2-(1-methylimidazol-2-yl)ethynyl]-3-(3,4,5-trimethoxyphenyl)-1,2-oxazole.
| Compound Name | 5-methyl-4-[2-(1-methylimidazol-2-yl)ethynyl]-3-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 24761229 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 5-methyl-4-[2-(1-methylimidazol-2-yl)ethynyl]-3-(3,4,5-trimethoxyphenyl)-1,2-oxazole |
| SMILES | COc1cc(-c2noc(C)c2C#Cc2nccn2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H19N3O4/c1-12-14(6-7-17-20-8-9-22(17)2)18(21-26-12)13-10-15(23-3)19(25-5)16(11-13)24-4/h8-11H,1-5H3 |
| InChIKey | YNCQFVAVWUBVJA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|