About 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one
1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one (PubChem CID 24761262) has the molecular formula C21H34N2O2
and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one |
| PubChem CID | 24761262 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one |
| SMILES | CCCCCCCN1CCC(=O)N([C@H](CO)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H34N2O2/c1-2-3-4-5-9-13-22-14-12-21(25)23(16-15-22)20(18-24)17-19-10-7-6-8-11-19/h6-8,10-11,20,24H,2-5,9,12-18H2,1H3/t20-/m0/s1 |
| InChIKey | RMYZFVAOIVUOKB-FQEVSTJZSA-N |
| XLogP | 3.09 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one?
The IUPAC name of 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one (CID 24761262) is 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one?
The canonical SMILES for 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one is CCCCCCCN1CCC(=O)N([C@H](CO)Cc2ccccc2)CC1.
What is the InChIKey of 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one?
The InChIKey is RMYZFVAOIVUOKB-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H34N2O2/c1-2-3-4-5-9-13-22-14-12-21(25)23(16-15-22)20(18-24)17-19-10-7-6-8-11-19/h6-8,10-11,20,24H,2-5,9,12-18H2,1H3/t20-/m0/s1.
What are the key properties of 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one?
1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one has a molecular weight of 346.51 g/mol, XLogP of 3.09, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-4-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-1,4-diazepan-5-one is sourced from PubChem (CID 24761262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).