About 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole
3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole (PubChem CID 24761296) has the molecular formula C22H14N2O3S
and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole |
| PubChem CID | 24761296 |
| Molecular Formula | C22H14N2O3S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole |
| SMILES | c1cc2cc(-c3c(-c4ccc5c(c4)OCO5)noc3-c3ccsc3)ccc2[nH]1 |
| InChI | InChI=1S/C22H14N2O3S/c1-3-17-13(5-7-23-17)9-14(1)20-21(24-27-22(20)16-6-8-28-11-16)15-2-4-18-19(10-15)26-12-25-18/h1-11,23H,12H2 |
| InChIKey | VDUWUDNNQOTQJY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole (CID 24761296) is 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole is c1cc2cc(-c3c(-c4ccc5c(c4)OCO5)noc3-c3ccsc3)ccc2[nH]1.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole?
The InChIKey is VDUWUDNNQOTQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N2O3S/c1-3-17-13(5-7-23-17)9-14(1)20-21(24-27-22(20)16-6-8-28-11-16)15-2-4-18-19(10-15)26-12-25-18/h1-11,23H,12H2.
What are the key properties of 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole?
3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole has a molecular weight of 386.43 g/mol, XLogP of 5.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-4-(1H-indol-5-yl)-5-thiophen-3-yl-1,2-oxazole is sourced from PubChem (CID 24761296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).