About 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole
3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole (PubChem CID 24761326) has the molecular formula C21H14N2O2
and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole |
| PubChem CID | 24761326 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole |
| SMILES | c1ccc(-c2onc(-c3ccco3)c2-c2ccc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C21H14N2O2/c1-2-5-14(6-3-1)21-19(20(23-25-21)18-7-4-12-24-18)16-8-9-17-15(13-16)10-11-22-17/h1-13,22H |
| InChIKey | WEAFZWKWDHLXNM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole?
The IUPAC name of 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole (CID 24761326) is 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole.
What is the SMILES notation for 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole?
The canonical SMILES for 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole is c1ccc(-c2onc(-c3ccco3)c2-c2ccc3[nH]ccc3c2)cc1.
What is the InChIKey of 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole?
The InChIKey is WEAFZWKWDHLXNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2O2/c1-2-5-14(6-3-1)21-19(20(23-25-21)18-7-4-12-24-18)16-8-9-17-15(13-16)10-11-22-17/h1-13,22H.
What are the key properties of 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole?
3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole has a molecular weight of 326.36 g/mol, XLogP of 5.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-4-(1H-indol-5-yl)-5-phenyl-1,2-oxazole is sourced from PubChem (CID 24761326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).