About ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate
ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate (PubChem CID 24761327) has the molecular formula C22H16FNO4
and a molecular weight of 377.37 g/mol. Its IUPAC name is ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate |
| PubChem CID | 24761327 |
| Molecular Formula | C22H16FNO4 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c(-c3ccco3)noc2-c2ccccc2)cc1F |
| InChI | InChI=1S/C22H16FNO4/c1-2-26-22(25)16-11-10-15(13-17(16)23)19-20(18-9-6-12-27-18)24-28-21(19)14-7-4-3-5-8-14/h3-13H,2H2,1H3 |
| InChIKey | UTBIIZNCLGBTFG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate?
The IUPAC name of ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate (CID 24761327) is ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate.
What is the SMILES notation for ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate?
The canonical SMILES for ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate is CCOC(=O)c1ccc(-c2c(-c3ccco3)noc2-c2ccccc2)cc1F.
What is the InChIKey of ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate?
The InChIKey is UTBIIZNCLGBTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FNO4/c1-2-26-22(25)16-11-10-15(13-17(16)23)19-20(18-9-6-12-27-18)24-28-21(19)14-7-4-3-5-8-14/h3-13H,2H2,1H3.
What are the key properties of ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate?
ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate has a molecular weight of 377.37 g/mol, XLogP of 5.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-4-[3-(furan-2-yl)-5-phenyl-1,2-oxazol-4-yl]benzoate is sourced from PubChem (CID 24761327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).