About 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride
1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride (PubChem CID 24761367) has the molecular formula C22H31ClN2O3
and a molecular weight of 406.95 g/mol. Its IUPAC name is 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride |
| PubChem CID | 24761367 |
| Molecular Formula | C22H31ClN2O3 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride |
| SMILES | COc1ccc(N2CCN(CC(O)COc3ccc(C)cc3C)CC2)cc1.Cl |
| InChI | InChI=1S/C22H30N2O3.ClH/c1-17-4-9-22(18(2)14-17)27-16-20(25)15-23-10-12-24(13-11-23)19-5-7-21(26-3)8-6-19;/h4-9,14,20,25H,10-13,15-16H2,1-3H3;1H |
| InChIKey | JAUPQOVTVRTKNU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
The IUPAC name of 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride (CID 24761367) is 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride.
What is the SMILES notation for 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
The canonical SMILES for 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride is COc1ccc(N2CCN(CC(O)COc3ccc(C)cc3C)CC2)cc1.Cl.
What is the InChIKey of 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
The InChIKey is JAUPQOVTVRTKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O3.ClH/c1-17-4-9-22(18(2)14-17)27-16-20(25)15-23-10-12-24(13-11-23)19-5-7-21(26-3)8-6-19;/h4-9,14,20,25H,10-13,15-16H2,1-3H3;1H.
What are the key properties of 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride?
1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride has a molecular weight of 406.95 g/mol, XLogP of 3.30, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol;hydrochloride is sourced from PubChem (CID 24761367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).