About 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one
3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one (PubChem CID 24761399) has the molecular formula C27H27N5O5
and a molecular weight of 501.54 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one |
| PubChem CID | 24761399 |
| Molecular Formula | C27H27N5O5 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one |
| SMILES | COc1ccc(-n2c(CN3CCN(c4ccccc4)CC3)nc3ccc([N+](=O)[O-])cc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C27H27N5O5/c1-36-21-9-11-24(25(17-21)37-2)31-26(28-23-10-8-20(32(34)35)16-22(23)27(31)33)18-29-12-14-30(15-13-29)19-6-4-3-5-7-19/h3-11,16-17H,12-15,18H2,1-2H3 |
| InChIKey | RDHXKGALOHFPIQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one (CID 24761399) is 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one is COc1ccc(-n2c(CN3CCN(c4ccccc4)CC3)nc3ccc([N+](=O)[O-])cc3c2=O)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one?
The InChIKey is RDHXKGALOHFPIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27N5O5/c1-36-21-9-11-24(25(17-21)37-2)31-26(28-23-10-8-20(32(34)35)16-22(23)27(31)33)18-29-12-14-30(15-13-29)19-6-4-3-5-7-19/h3-11,16-17H,12-15,18H2,1-2H3.
What are the key properties of 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one?
3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one has a molecular weight of 501.54 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-6-nitro-2-[(4-phenylpiperazin-1-yl)methyl]quinazolin-4-one is sourced from PubChem (CID 24761399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).