About (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide
(2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide (PubChem CID 24761406) has the molecular formula C16H17IN2OS
and a molecular weight of 412.30 g/mol. Its IUPAC name is (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide.
Molecular Properties
| Compound Name | (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide |
| PubChem CID | 24761406 |
| Molecular Formula | C16H17IN2OS |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide |
| SMILES | COc1ccc2c(c1)N(C)/C(=C/c1cccc[n+]1C)S2.[I-] |
| InChI | InChI=1S/C16H17N2OS.HI/c1-17-9-5-4-6-12(17)10-16-18(2)14-11-13(19-3)7-8-15(14)20-16;/h4-11H,1-3H3;1H/q+1;/p-1 |
| InChIKey | GQOUNLWLXAVPSS-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
The IUPAC name of (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide (CID 24761406) is (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide.
What is the SMILES notation for (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
The canonical SMILES for (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide is COc1ccc2c(c1)N(C)/C(=C/c1cccc[n+]1C)S2.[I-].
What is the InChIKey of (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
The InChIKey is GQOUNLWLXAVPSS-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H17N2OS.HI/c1-17-9-5-4-6-12(17)10-16-18(2)14-11-13(19-3)7-8-15(14)20-16;/h4-11H,1-3H3;1H/q+1;/p-1.
What are the key properties of (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide?
(2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide has a molecular weight of 412.30 g/mol, XLogP of 0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-5-methoxy-3-methyl-2-[(1-methylpyridin-1-ium-2-yl)methylidene]-1,3-benzothiazole iodide is sourced from PubChem (CID 24761406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).