About 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride
2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride (PubChem CID 24761477) has the molecular formula C18H28ClNO3
and a molecular weight of 341.88 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride |
| PubChem CID | 24761477 |
| Molecular Formula | C18H28ClNO3 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride |
| SMILES | CC(C)COc1ccc(C(=O)OCCN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C18H27NO3.ClH/c1-15(2)14-22-17-8-6-16(7-9-17)18(20)21-13-12-19-10-4-3-5-11-19;/h6-9,15H,3-5,10-14H2,1-2H3;1H |
| InChIKey | VYGUGCJNQQAMIB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride?
The IUPAC name of 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride (CID 24761477) is 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride.
What is the SMILES notation for 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride?
The canonical SMILES for 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride is CC(C)COc1ccc(C(=O)OCCN2CCCCC2)cc1.Cl.
What is the InChIKey of 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride?
The InChIKey is VYGUGCJNQQAMIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO3.ClH/c1-15(2)14-22-17-8-6-16(7-9-17)18(20)21-13-12-19-10-4-3-5-11-19;/h6-9,15H,3-5,10-14H2,1-2H3;1H.
What are the key properties of 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride?
2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride has a molecular weight of 341.88 g/mol, XLogP of 3.79, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 4-(2-methylpropoxy)benzoate;hydrochloride is sourced from PubChem (CID 24761477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).