C19H17F6NO4S — CID 24761517
1-[4-(trifluoromethoxy)phenyl]sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 24761517) has the molecular formula C19H17F6NO4S and a molecular weight of 469.40 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 24761517 |
| Molecular Formula | C19H17F6NO4S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]sulfonyl-4-[3-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CCC(O)(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H17F6NO4S/c20-18(21,22)14-3-1-2-13(12-14)17(27)8-10-26(11-9-17)31(28,29)16-6-4-15(5-7-16)30-19(23,24)25/h1-7,12,27H,8-11H2 |
| InChIKey | RBZMPHVUMXYNPO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |