About 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione
2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione (PubChem CID 24761574) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione |
| PubChem CID | 24761574 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione |
| SMILES | Cc1cc(C)cc(NC2=C(N)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C18H16N2O2/c1-10-7-11(2)9-12(8-10)20-16-15(19)17(21)13-5-3-4-6-14(13)18(16)22/h3-9,20H,19H2,1-2H3 |
| InChIKey | UECMZHMZCBWVGW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione?
The IUPAC name of 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione (CID 24761574) is 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione.
What is the SMILES notation for 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione?
The canonical SMILES for 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione is Cc1cc(C)cc(NC2=C(N)C(=O)c3ccccc3C2=O)c1.
What is the InChIKey of 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione?
The InChIKey is UECMZHMZCBWVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c1-10-7-11(2)9-12(8-10)20-16-15(19)17(21)13-5-3-4-6-14(13)18(16)22/h3-9,20H,19H2,1-2H3.
What are the key properties of 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione?
2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione has a molecular weight of 292.34 g/mol, XLogP of 2.96, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3,5-dimethylanilino)naphthalene-1,4-dione is sourced from PubChem (CID 24761574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).