About 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride
2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride (PubChem CID 24761588) has the molecular formula C20H25ClN4O2
and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride |
| PubChem CID | 24761588 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride |
| SMILES | CCCOc1ccc2c(c1)C(=NN=C(N)N)c1cc(OCCC)ccc1-2.Cl |
| InChI | InChI=1S/C20H24N4O2.ClH/c1-3-9-25-13-5-7-15-16-8-6-14(26-10-4-2)12-18(16)19(17(15)11-13)23-24-20(21)22;/h5-8,11-12H,3-4,9-10H2,1-2H3,(H4,21,22,24);1H |
| InChIKey | LKADEPWNMWHPAD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride?
The IUPAC name of 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride (CID 24761588) is 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride.
What is the SMILES notation for 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride?
The canonical SMILES for 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride is CCCOc1ccc2c(c1)C(=NN=C(N)N)c1cc(OCCC)ccc1-2.Cl.
What is the InChIKey of 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride?
The InChIKey is LKADEPWNMWHPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O2.ClH/c1-3-9-25-13-5-7-15-16-8-6-14(26-10-4-2)12-18(16)19(17(15)11-13)23-24-20(21)22;/h5-8,11-12H,3-4,9-10H2,1-2H3,(H4,21,22,24);1H.
What are the key properties of 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride?
2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride has a molecular weight of 388.90 g/mol, XLogP of 3.69, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,7-dipropoxyfluoren-9-ylidene)amino]guanidine;hydrochloride is sourced from PubChem (CID 24761588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).