About N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride
N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride (PubChem CID 24761673) has the molecular formula C15H24ClN3O3S
and a molecular weight of 361.90 g/mol. Its IUPAC name is N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride |
| PubChem CID | 24761673 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)N2CCCN(C)CC2)cc1.Cl |
| InChI | InChI=1S/C15H23N3O3S.ClH/c1-13(19)16-12-14-4-6-15(7-5-14)22(20,21)18-9-3-8-17(2)10-11-18;/h4-7H,3,8-12H2,1-2H3,(H,16,19);1H |
| InChIKey | SHPBGJIIMAWNGI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride?
The IUPAC name of N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride (CID 24761673) is N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride.
What is the SMILES notation for N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride?
The canonical SMILES for N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride is CC(=O)NCc1ccc(S(=O)(=O)N2CCCN(C)CC2)cc1.Cl.
What is the InChIKey of N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride?
The InChIKey is SHPBGJIIMAWNGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O3S.ClH/c1-13(19)16-12-14-4-6-15(7-5-14)22(20,21)18-9-3-8-17(2)10-11-18;/h4-7H,3,8-12H2,1-2H3,(H,16,19);1H.
What are the key properties of N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride?
N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride has a molecular weight of 361.90 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]phenyl]methyl]acetamide;hydrochloride is sourced from PubChem (CID 24761673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).