About (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide
(4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide (PubChem CID 24761694) has the molecular formula C16H14F3NO3S
and a molecular weight of 357.35 g/mol. Its IUPAC name is (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide.
Molecular Properties
| Compound Name | (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide |
| PubChem CID | 24761694 |
| Molecular Formula | C16H14F3NO3S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide |
| SMILES | O=S1(=O)N[C@H](c2ccccc2)C[C@H](c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C16H14F3NO3S/c17-16(18,19)13-8-6-12(7-9-13)15-10-14(20-24(21,22)23-15)11-4-2-1-3-5-11/h1-9,14-15,20H,10H2/t14-,15+/m0/s1 |
| InChIKey | XTWXAAQMSZKKJL-LSDHHAIUSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide?
The IUPAC name of (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide (CID 24761694) is (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide.
What is the SMILES notation for (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide?
The canonical SMILES for (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide is O=S1(=O)N[C@H](c2ccccc2)C[C@H](c2ccc(C(F)(F)F)cc2)O1.
What is the InChIKey of (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide?
The InChIKey is XTWXAAQMSZKKJL-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H14F3NO3S/c17-16(18,19)13-8-6-12(7-9-13)15-10-14(20-24(21,22)23-15)11-4-2-1-3-5-11/h1-9,14-15,20H,10H2/t14-,15+/m0/s1.
What are the key properties of (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide?
(4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide has a molecular weight of 357.35 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,6R)-4-phenyl-6-[4-(trifluoromethyl)phenyl]oxathiazinane 2,2-dioxide is sourced from PubChem (CID 24761694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).