C13H20Cl6N2O6S2 — CID 24761767
2,2,2-trichloroethyl N-[(1S,3R)-3-(2,2,2-trichloroethoxysulfonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]sulfamate (PubChem CID 24761767) has the molecular formula C13H20Cl6N2O6S2 and a molecular weight of 577.16 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(1S,3R)-3-(2,2,2-trichloroethoxysulfonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]sulfamate.
| Compound Name | 2,2,2-trichloroethyl N-[(1S,3R)-3-(2,2,2-trichloroethoxysulfonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]sulfamate |
|---|---|
| PubChem CID | 24761767 |
| Molecular Formula | C13H20Cl6N2O6S2 |
| Molecular Weight | 577.16 g/mol |
| Exact Mass | 573.89 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(1S,3R)-3-(2,2,2-trichloroethoxysulfonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]sulfamate |
| SMILES | O=S(=O)(N[C@H]1C[C@@H](NS(=O)(=O)OCC(Cl)(Cl)Cl)C2CCCCC21)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H20Cl6N2O6S2/c14-12(15,16)6-26-28(22,23)20-10-5-11(9-4-2-1-3-8(9)10)21-29(24,25)27-7-13(17,18)19/h8-11,20-21H,1-7H2/t8?,9?,10-,11+ |
| InChIKey | ORQILLPOCQBVNP-HWACXVBKSA-N |
| XLogP | 3.38 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|