About 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate
2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate (PubChem CID 24761800) has the molecular formula C10H11BrCl3NO3S
and a molecular weight of 411.53 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate |
| PubChem CID | 24761800 |
| Molecular Formula | C10H11BrCl3NO3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 408.87 |
| IUPAC Name | 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate |
| SMILES | CC(NS(=O)(=O)OCC(Cl)(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H11BrCl3NO3S/c1-7(8-2-4-9(11)5-3-8)15-19(16,17)18-6-10(12,13)14/h2-5,7,15H,6H2,1H3 |
| InChIKey | AFZQCXNJLCCUGQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate?
The IUPAC name of 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate (CID 24761800) is 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate.
What is the SMILES notation for 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate?
The canonical SMILES for 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate is CC(NS(=O)(=O)OCC(Cl)(Cl)Cl)c1ccc(Br)cc1.
What is the InChIKey of 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate?
The InChIKey is AFZQCXNJLCCUGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrCl3NO3S/c1-7(8-2-4-9(11)5-3-8)15-19(16,17)18-6-10(12,13)14/h2-5,7,15H,6H2,1H3.
What are the key properties of 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate?
2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate has a molecular weight of 411.53 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl N-[1-(4-bromophenyl)ethyl]sulfamate is sourced from PubChem (CID 24761800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).