C24H33N3O4 — CID 24761934
2-N,6-N-dicyclopentyl-7-methyl-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 24761934) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-N,6-N-dicyclopentyl-7-methyl-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-dicyclopentyl-7-methyl-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 24761934 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-N,6-N-dicyclopentyl-7-methyl-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C=CCN1C(=O)C2C(C(=O)NC3CCCC3)C3(C)C=CC2(O3)C1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H33N3O4/c1-3-14-27-19(21(29)26-16-10-6-7-11-16)24-13-12-23(2,31-24)17(18(24)22(27)30)20(28)25-15-8-4-5-9-15/h3,12-13,15-19H,1,4-11,14H2,2H3,(H,25,28)(H,26,29) |
| InChIKey | BPBLWAOACBTLHZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|