C23H28N2O4 — CID 24762127
N-(2,4-dimethoxyphenyl)-2-[4-(4-methylbenzoyl)piperidin-1-yl]acetamide (PubChem CID 24762127) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[4-(4-methylbenzoyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[4-(4-methylbenzoyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 24762127 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[4-(4-methylbenzoyl)piperidin-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCC(C(=O)c3ccc(C)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-16-4-6-17(7-5-16)23(27)18-10-12-25(13-11-18)15-22(26)24-20-9-8-19(28-2)14-21(20)29-3/h4-9,14,18H,10-13,15H2,1-3H3,(H,24,26) |
| InChIKey | FGCUDDHIUHOEQF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |