About Purfalcamine
Purfalcamine (PubChem CID 24762166) has the molecular formula C29H33FN8O
and a molecular weight of 528.60 g/mol. Its IUPAC name is [4-[[2-[(4-aminocyclohexyl)amino]-9-(3-fluorophenyl)purin-6-yl]amino]phenyl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | Purfalcamine |
| PubChem CID | 24762166 |
| Molecular Formula | C29H33FN8O |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | [4-[[2-[(4-aminocyclohexyl)amino]-9-(3-fluorophenyl)purin-6-yl]amino]phenyl]-piperidin-1-ylmethanone |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)NC3=C4C(=NC(=N3)NC5CCC(CC5)N)N(C=N4)C6=CC(=CC=C6)F |
| InChI | InChI=1S/C29H33FN8O/c30-20-5-4-6-24(17-20)38-18-32-25-26(35-29(36-27(25)38)34-23-13-9-21(31)10-14-23)33-22-11-7-19(8-12-22)28(39)37-15-2-1-3-16-37/h4-8,11-12,17-18,21,23H,1-3,9-10,13-16,31H2,(H2,33,34,35,36) |
| InChIKey | KRCOMOOXOZSNAJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | 798 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Purfalcamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Purfalcamine?
The IUPAC name of Purfalcamine (CID 24762166) is [4-[[2-[(4-aminocyclohexyl)amino]-9-(3-fluorophenyl)purin-6-yl]amino]phenyl]-piperidin-1-ylmethanone.
What is the SMILES notation for Purfalcamine?
The canonical SMILES for Purfalcamine is C1CCN(CC1)C(=O)C2=CC=C(C=C2)NC3=C4C(=NC(=N3)NC5CCC(CC5)N)N(C=N4)C6=CC(=CC=C6)F.
What is the InChIKey of Purfalcamine?
The InChIKey is KRCOMOOXOZSNAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33FN8O/c30-20-5-4-6-24(17-20)38-18-32-25-26(35-29(36-27(25)38)34-23-13-9-21(31)10-14-23)33-22-11-7-19(8-12-22)28(39)37-15-2-1-3-16-37/h4-8,11-12,17-18,21,23H,1-3,9-10,13-16,31H2,(H2,33,34,35,36).
What are the key properties of Purfalcamine?
Purfalcamine has a molecular weight of 528.60 g/mol, XLogP of 4.70, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Purfalcamine is sourced from PubChem (CID 24762166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).