C36H40N8O2 — CID 24762167
[4-[[2-[(4-aminocyclohexyl)amino]-9-(3-phenylmethoxyphenyl)purin-6-yl]amino]phenyl]-piperidin-1-ylmethanone (PubChem CID 24762167) has the molecular formula C36H40N8O2 and a molecular weight of 616.77 g/mol. Its IUPAC name is [4-[[2-[(4-aminocyclohexyl)amino]-9-(3-phenylmethoxyphenyl)purin-6-yl]amino]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[[2-[(4-aminocyclohexyl)amino]-9-(3-phenylmethoxyphenyl)purin-6-yl]amino]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 24762167 |
| Molecular Formula | C36H40N8O2 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | [4-[[2-[(4-aminocyclohexyl)amino]-9-(3-phenylmethoxyphenyl)purin-6-yl]amino]phenyl]-piperidin-1-ylmethanone |
| SMILES | NC1CCC(Nc2nc(Nc3ccc(C(=O)N4CCCCC4)cc3)c3ncn(-c4cccc(OCc5ccccc5)c4)c3n2)CC1 |
| InChI | InChI=1S/C36H40N8O2/c37-27-14-18-29(19-15-27)40-36-41-33(39-28-16-12-26(13-17-28)35(45)43-20-5-2-6-21-43)32-34(42-36)44(24-38-32)30-10-7-11-31(22-30)46-23-25-8-3-1-4-9-25/h1,3-4,7-13,16-17,22,24,27,29H,2,5-6,14-15,18-21,23,37H2,(H2,39,40,41,42) |
| InChIKey | AWCNCBAUXOAKPA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |