C38H38N2O4+2 — CID 24762224
2-[4-[4-(6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium-2-yl)phenyl]phenyl]-6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium (PubChem CID 24762224) has the molecular formula C38H38N2O4+2 and a molecular weight of 586.73 g/mol. Its IUPAC name is 2-[4-[4-(6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium-2-yl)phenyl]phenyl]-6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium.
| Compound Name | 2-[4-[4-(6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium-2-yl)phenyl]phenyl]-6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 24762224 |
| Molecular Formula | C38H38N2O4+2 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 2-[4-[4-(6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium-2-yl)phenyl]phenyl]-6,8-dimethoxy-1,3-dimethylisoquinolin-2-ium |
| SMILES | COc1cc(OC)c2c(C)[n+](-c3ccc(-c4ccc(-[n+]5c(C)cc6cc(OC)cc(OC)c6c5C)cc4)cc3)c(C)cc2c1 |
| InChI | InChI=1S/C38H38N2O4/c1-23-17-29-19-33(41-5)21-35(43-7)37(29)25(3)39(23)31-13-9-27(10-14-31)28-11-15-32(16-12-28)40-24(2)18-30-20-34(42-6)22-36(44-8)38(30)26(40)4/h9-22H,1-8H3/q+2 |
| InChIKey | KBPIMZSTTHOKGU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|