C12H15F3N3OS+ — CID 2476227
(E)-4-[(5-ethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 2476227) has the molecular formula C12H15F3N3OS+ and a molecular weight of 306.33 g/mol. Its IUPAC name is (E)-4-[(5-ethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (E)-4-[(5-ethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 2476227 |
| Molecular Formula | C12H15F3N3OS+ |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (E)-4-[(5-ethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-yl)amino]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CC[NH+]1CCc2nc(N/C=C/C(=O)C(F)(F)F)sc2C1 |
| InChI | InChI=1S/C12H14F3N3OS/c1-2-18-6-4-8-9(7-18)20-11(17-8)16-5-3-10(19)12(13,14)15/h3,5H,2,4,6-7H2,1H3,(H,16,17)/p+1/b5-3+ |
| InChIKey | JMEKHBFFIRNLKT-HWKANZROSA-O |
| XLogP | 1.16 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|