About 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol
4,7-dimethoxy-9,10-dihydrophenanthren-2-ol (PubChem CID 24762426) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol.
Molecular Properties
| Compound Name | 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol |
| PubChem CID | 24762426 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol |
| SMILES | COc1ccc2c(c1)CCc1cc(O)cc(OC)c1-2 |
| InChI | InChI=1S/C16H16O3/c1-18-13-5-6-14-10(8-13)3-4-11-7-12(17)9-15(19-2)16(11)14/h5-9,17H,3-4H2,1-2H3 |
| InChIKey | HWILQAUQOIOQMW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol?
The IUPAC name of 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol (CID 24762426) is 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol.
What is the SMILES notation for 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol?
The canonical SMILES for 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol is COc1ccc2c(c1)CCc1cc(O)cc(OC)c1-2.
What is the InChIKey of 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol?
The InChIKey is HWILQAUQOIOQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-18-13-5-6-14-10(8-13)3-4-11-7-12(17)9-15(19-2)16(11)14/h5-9,17H,3-4H2,1-2H3.
What are the key properties of 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol?
4,7-dimethoxy-9,10-dihydrophenanthren-2-ol has a molecular weight of 256.30 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethoxy-9,10-dihydrophenanthren-2-ol is sourced from PubChem (CID 24762426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).