About 4,9-dimethoxyphenanthrene-2,3,5-triol
4,9-dimethoxyphenanthrene-2,3,5-triol (PubChem CID 24762428) has the molecular formula C16H14O5
and a molecular weight of 286.28 g/mol. Its IUPAC name is 4,9-dimethoxyphenanthrene-2,3,5-triol.
Molecular Properties
| Compound Name | 4,9-dimethoxyphenanthrene-2,3,5-triol |
| PubChem CID | 24762428 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4,9-dimethoxyphenanthrene-2,3,5-triol |
| SMILES | COc1cc2cc(O)c(O)c(OC)c2c2c(O)cccc12 |
| InChI | InChI=1S/C16H14O5/c1-20-12-7-8-6-11(18)15(19)16(21-2)13(8)14-9(12)4-3-5-10(14)17/h3-7,17-19H,1-2H3 |
| InChIKey | GSABLXRGQAKZDS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4,9-dimethoxyphenanthrene-2,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethoxyphenanthrene-2,3,5-triol?
The IUPAC name of 4,9-dimethoxyphenanthrene-2,3,5-triol (CID 24762428) is 4,9-dimethoxyphenanthrene-2,3,5-triol.
What is the SMILES notation for 4,9-dimethoxyphenanthrene-2,3,5-triol?
The canonical SMILES for 4,9-dimethoxyphenanthrene-2,3,5-triol is COc1cc2cc(O)c(O)c(OC)c2c2c(O)cccc12.
What is the InChIKey of 4,9-dimethoxyphenanthrene-2,3,5-triol?
The InChIKey is GSABLXRGQAKZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c1-20-12-7-8-6-11(18)15(19)16(21-2)13(8)14-9(12)4-3-5-10(14)17/h3-7,17-19H,1-2H3.
What are the key properties of 4,9-dimethoxyphenanthrene-2,3,5-triol?
4,9-dimethoxyphenanthrene-2,3,5-triol has a molecular weight of 286.28 g/mol, XLogP of 3.13, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethoxyphenanthrene-2,3,5-triol is sourced from PubChem (CID 24762428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).