About 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid
2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 24762487) has the molecular formula C19H27NO5
and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
| PubChem CID | 24762487 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | C/C(=N/OCCCCC1COC(C)(C(=O)O)OC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO5/c1-14-7-9-17(10-8-14)15(2)20-25-11-5-4-6-16-12-23-19(3,18(21)22)24-13-16/h7-10,16H,4-6,11-13H2,1-3H3,(H,21,22)/b20-15- |
| InChIKey | RCCQWECWEOBUAE-HKWRFOASSA-N |
| XLogP | 3.37 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid?
The IUPAC name of 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid (CID 24762487) is 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid.
What is the SMILES notation for 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid?
The canonical SMILES for 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid is C/C(=N/OCCCCC1COC(C)(C(=O)O)OC1)c1ccc(C)cc1.
What is the InChIKey of 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid?
The InChIKey is RCCQWECWEOBUAE-HKWRFOASSA-N. The full InChI is InChI=1S/C19H27NO5/c1-14-7-9-17(10-8-14)15(2)20-25-11-5-4-6-16-12-23-19(3,18(21)22)24-13-16/h7-10,16H,4-6,11-13H2,1-3H3,(H,21,22)/b20-15-.
What are the key properties of 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid?
2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid has a molecular weight of 349.43 g/mol, XLogP of 3.37, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[4-[(Z)-1-(4-methylphenyl)ethylideneamino]oxybutyl]-1,3-dioxane-2-carboxylic acid is sourced from PubChem (CID 24762487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).