C28H37NO3 — CID 24762909
(3E,5S,10S,13S)-5-hydroxy-15-[2-(4-hydroxyphenyl)ethyl]-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-1(16),3-dien-14-one (PubChem CID 24762909) has the molecular formula C28H37NO3 and a molecular weight of 435.61 g/mol. Its IUPAC name is (3E,5S,10S,13S)-5-hydroxy-15-[2-(4-hydroxyphenyl)ethyl]-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-1(16),3-dien-14-one.
| Compound Name | (3E,5S,10S,13S)-5-hydroxy-15-[2-(4-hydroxyphenyl)ethyl]-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-1(16),3-dien-14-one |
|---|---|
| PubChem CID | 24762909 |
| Molecular Formula | C28H37NO3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | (3E,5S,10S,13S)-5-hydroxy-15-[2-(4-hydroxyphenyl)ethyl]-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-1(16),3-dien-14-one |
| SMILES | C=C1CC[C@@H]2CC[C@@H]3C(=O)N(CCc4ccc(O)cc4)C(=C3C2(C)C)C/C(C)=C/[C@@H](O)C1 |
| InChI | InChI=1S/C28H37NO3/c1-18-5-8-21-9-12-24-26(28(21,3)4)25(17-19(2)16-23(31)15-18)29(27(24)32)14-13-20-6-10-22(30)11-7-20/h6-7,10-11,16,21,23-24,30-31H,1,5,8-9,12-15,17H2,2-4H3/b19-16+/t21-,23+,24+/m1/s1 |
| InChIKey | USYVWERWVKDSSW-KXBDFOAZSA-N |
| XLogP | 5.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|