C20H29NO2 — CID 24762910
(1R,3E,5S,10R)-5-hydroxy-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-14-one (PubChem CID 24762910) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (1R,3E,5S,10R)-5-hydroxy-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-14-one.
| Compound Name | (1R,3E,5S,10R)-5-hydroxy-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-14-one |
|---|---|
| PubChem CID | 24762910 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (1R,3E,5S,10R)-5-hydroxy-3,17,17-trimethyl-7-methylidene-15-azatricyclo[8.5.2.013,16]heptadeca-3,13(16)-dien-14-one |
| SMILES | C=C1CC[C@@H]2CCC3=C([C@@H](C/C(C)=C/[C@@H](O)C1)NC3=O)C2(C)C |
| InChI | InChI=1S/C20H29NO2/c1-12-5-6-14-7-8-16-18(20(14,3)4)17(21-19(16)23)11-13(2)10-15(22)9-12/h10,14-15,17,22H,1,5-9,11H2,2-4H3,(H,21,23)/b13-10+/t14-,15+,17-/m1/s1 |
| InChIKey | DZPGQVGXKGIMGH-CZIVKBJPSA-N |
| XLogP | 3.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|