About 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid
5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid (PubChem CID 24762977) has the molecular formula C20H29NO5
and a molecular weight of 363.45 g/mol. Its IUPAC name is 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid |
| PubChem CID | 24762977 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid |
| SMILES | CCc1ccc(/C(C)=N\OCCCCC2COC(C)(C(=O)O)OC2)cc1 |
| InChI | InChI=1S/C20H29NO5/c1-4-16-8-10-18(11-9-16)15(2)21-26-12-6-5-7-17-13-24-20(3,19(22)23)25-14-17/h8-11,17H,4-7,12-14H2,1-3H3,(H,22,23)/b21-15- |
| InChIKey | AGXPNHIGUOXQOH-QNGOZBTKSA-N |
| XLogP | 3.62 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid?
The IUPAC name of 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid (CID 24762977) is 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid.
What is the SMILES notation for 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid?
The canonical SMILES for 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid is CCc1ccc(/C(C)=N\OCCCCC2COC(C)(C(=O)O)OC2)cc1.
What is the InChIKey of 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid?
The InChIKey is AGXPNHIGUOXQOH-QNGOZBTKSA-N. The full InChI is InChI=1S/C20H29NO5/c1-4-16-8-10-18(11-9-16)15(2)21-26-12-6-5-7-17-13-24-20(3,19(22)23)25-14-17/h8-11,17H,4-7,12-14H2,1-3H3,(H,22,23)/b21-15-.
What are the key properties of 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid?
5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid has a molecular weight of 363.45 g/mol, XLogP of 3.62, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(Z)-1-(4-ethylphenyl)ethylideneamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylic acid is sourced from PubChem (CID 24762977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).