C21H31NO5 — CID 24763052
5-[5-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]oxypentyl]-2-methyl-1,3-dioxane-2-carboxylic acid (PubChem CID 24763052) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is 5-[5-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]oxypentyl]-2-methyl-1,3-dioxane-2-carboxylic acid.
| Compound Name | 5-[5-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]oxypentyl]-2-methyl-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 24763052 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 5-[5-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]oxypentyl]-2-methyl-1,3-dioxane-2-carboxylic acid |
| SMILES | C/C(=N/OCCCCCC1COC(C)(C(=O)O)OC1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H31NO5/c1-15-9-10-19(12-16(15)2)17(3)22-27-11-7-5-6-8-18-13-25-21(4,20(23)24)26-14-18/h9-10,12,18H,5-8,11,13-14H2,1-4H3,(H,23,24)/b22-17- |
| InChIKey | KJXZITCQMPHLEO-XLNRJJMWSA-N |
| XLogP | 4.07 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|