About [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate
[(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 24763224) has the molecular formula C14H19N3O6
and a molecular weight of 325.32 g/mol. Its IUPAC name is [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
Molecular Properties
| Compound Name | [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| PubChem CID | 24763224 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | NC(=O)CCC(=O)NOC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H19N3O6/c15-10(18)5-6-11(19)16-23-14(22)4-2-1-3-9-17-12(20)7-8-13(17)21/h7-8H,1-6,9H2,(H2,15,18)(H,16,19) |
| InChIKey | CKLAIRBQHGNHJV-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The IUPAC name of [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate (CID 24763224) is [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
What is the SMILES notation for [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The canonical SMILES for [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate is NC(=O)CCC(=O)NOC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The InChIKey is CKLAIRBQHGNHJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O6/c15-10(18)5-6-11(19)16-23-14(22)4-2-1-3-9-17-12(20)7-8-13(17)21/h7-8H,1-6,9H2,(H2,15,18)(H,16,19).
What are the key properties of [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
[(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate has a molecular weight of 325.32 g/mol, XLogP of -0.69, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-amino-4-oxobutanoyl)amino] 6-(2,5-dioxopyrrol-1-yl)hexanoate is sourced from PubChem (CID 24763224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).