About methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate
methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate (PubChem CID 24763625) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate |
| PubChem CID | 24763625 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate |
| SMILES | COC(=O)CN1CCSc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C13H17NO3S/c1-16-11-3-4-12-10(7-11)8-14(5-6-18-12)9-13(15)17-2/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | WIOIUMAETYQIQB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate?
The IUPAC name of methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate (CID 24763625) is methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate.
What is the SMILES notation for methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate?
The canonical SMILES for methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate is COC(=O)CN1CCSc2ccc(OC)cc2C1.
What is the InChIKey of methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate?
The InChIKey is WIOIUMAETYQIQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-16-11-3-4-12-10(7-11)8-14(5-6-18-12)9-13(15)17-2/h3-4,7H,5-6,8-9H2,1-2H3.
What are the key properties of methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate?
methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate has a molecular weight of 267.35 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)acetate is sourced from PubChem (CID 24763625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).