C39H32F3NO — CID 24763656
1-[4-[10,18-difluoro-5-(4-fluorophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]piperidine (PubChem CID 24763656) has the molecular formula C39H32F3NO and a molecular weight of 587.69 g/mol. Its IUPAC name is 1-[4-[10,18-difluoro-5-(4-fluorophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]piperidine.
| Compound Name | 1-[4-[10,18-difluoro-5-(4-fluorophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 24763656 |
| Molecular Formula | C39H32F3NO |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 1-[4-[10,18-difluoro-5-(4-fluorophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]piperidine |
| SMILES | CC1(C)c2cc(F)ccc2-c2c1c1c(c3cc(F)ccc23)OC(c2ccc(F)cc2)(c2ccc(N3CCCCC3)cc2)C=C1 |
| InChI | InChI=1S/C39H32F3NO/c1-38(2)34-23-28(42)13-17-31(34)35-30-16-12-27(41)22-33(30)37-32(36(35)38)18-19-39(44-37,24-6-10-26(40)11-7-24)25-8-14-29(15-9-25)43-20-4-3-5-21-43/h6-19,22-23H,3-5,20-21H2,1-2H3 |
| InChIKey | SCBDWXDCBQAAKH-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|