C19H32O6 — CID 24763934
(2R,3S,5S,6R)-2-methoxy-6-[3-[(2R,3S,5S,6R)-6-methoxy-3,5-dimethyl-4-oxooxan-2-yl]propyl]-3,5-dimethyloxan-4-one (PubChem CID 24763934) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is (2R,3S,5S,6R)-2-methoxy-6-[3-[(2R,3S,5S,6R)-6-methoxy-3,5-dimethyl-4-oxooxan-2-yl]propyl]-3,5-dimethyloxan-4-one.
| Compound Name | (2R,3S,5S,6R)-2-methoxy-6-[3-[(2R,3S,5S,6R)-6-methoxy-3,5-dimethyl-4-oxooxan-2-yl]propyl]-3,5-dimethyloxan-4-one |
|---|---|
| PubChem CID | 24763934 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2R,3S,5S,6R)-2-methoxy-6-[3-[(2R,3S,5S,6R)-6-methoxy-3,5-dimethyl-4-oxooxan-2-yl]propyl]-3,5-dimethyloxan-4-one |
| SMILES | CO[C@@H]1O[C@H](CCC[C@H]2O[C@@H](OC)[C@H](C)C(=O)[C@H]2C)[C@H](C)C(=O)[C@H]1C |
| InChI | InChI=1S/C19H32O6/c1-10-14(24-18(22-5)12(3)16(10)20)8-7-9-15-11(2)17(21)13(4)19(23-6)25-15/h10-15,18-19H,7-9H2,1-6H3/t10-,11-,12+,13+,14+,15+,18+,19+/m0/s1 |
| InChIKey | PTPCGUNIIVWFLA-SQXFOZHVSA-N |
| XLogP | 2.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |