C20H30O5 — CID 24764024
(1S,2S,4R,6E,8S,13R,15R)-6,14,14-trimethyl-10-methylidene-3,16-dioxatetracyclo[11.3.2.01,15.04,15]octadec-6-ene-2,4,8-triol (PubChem CID 24764024) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1S,2S,4R,6E,8S,13R,15R)-6,14,14-trimethyl-10-methylidene-3,16-dioxatetracyclo[11.3.2.01,15.04,15]octadec-6-ene-2,4,8-triol.
| Compound Name | (1S,2S,4R,6E,8S,13R,15R)-6,14,14-trimethyl-10-methylidene-3,16-dioxatetracyclo[11.3.2.01,15.04,15]octadec-6-ene-2,4,8-triol |
|---|---|
| PubChem CID | 24764024 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,2S,4R,6E,8S,13R,15R)-6,14,14-trimethyl-10-methylidene-3,16-dioxatetracyclo[11.3.2.01,15.04,15]octadec-6-ene-2,4,8-triol |
| SMILES | C=C1CC[C@@H]2CC[C@]34O[C@@]3(C2(C)C)[C@@](O)(C/C(C)=C/[C@@H](O)C1)O[C@@H]4O |
| InChI | InChI=1S/C20H30O5/c1-12-5-6-14-7-8-18-16(22)24-19(23,11-13(2)10-15(21)9-12)20(18,25-18)17(14,3)4/h10,14-16,21-23H,1,5-9,11H2,2-4H3/b13-10+/t14-,15+,16+,18-,19-,20-/m1/s1 |
| InChIKey | BKKZGQQWVCLVFK-QVBZYUHFSA-N |
| XLogP | 2.40 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|