About CID 24764040
CID 24764040 (PubChem CID 24764040) has the molecular formula C14H26NO2Si
and a molecular weight of 268.45 g/mol.
Molecular Properties
| Compound Name | CID 24764040 |
| PubChem CID | 24764040 |
| Molecular Formula | C14H26NO2Si |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(O)(C#C[Si](C)(C)C)CC(C)(C)N1[O] |
| InChI | InChI=1S/C14H26NO2Si/c1-12(2)10-14(16,8-9-18(5,6)7)11-13(3,4)15(12)17/h16H,10-11H2,1-7H3 |
| InChIKey | YSBZWGQRHCVREH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 24764040 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24764040?
The IUPAC name of CID 24764040 (CID 24764040) is not available.
What is the SMILES notation for CID 24764040?
The canonical SMILES for CID 24764040 is CC1(C)CC(O)(C#C[Si](C)(C)C)CC(C)(C)N1[O].
What is the InChIKey of CID 24764040?
The InChIKey is YSBZWGQRHCVREH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26NO2Si/c1-12(2)10-14(16,8-9-18(5,6)7)11-13(3,4)15(12)17/h16H,10-11H2,1-7H3.
What are the key properties of CID 24764040?
CID 24764040 has a molecular weight of 268.45 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24764040 is sourced from PubChem (CID 24764040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).