C15H22 — CID 24764079
(4R)-1-methyl-4-[(2E,4E)-6-methylhepta-2,4,6-trien-2-yl]cyclohexene (PubChem CID 24764079) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is (4R)-1-methyl-4-[(2E,4E)-6-methylhepta-2,4,6-trien-2-yl]cyclohexene.
| Compound Name | (4R)-1-methyl-4-[(2E,4E)-6-methylhepta-2,4,6-trien-2-yl]cyclohexene |
|---|---|
| PubChem CID | 24764079 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (4R)-1-methyl-4-[(2E,4E)-6-methylhepta-2,4,6-trien-2-yl]cyclohexene |
| SMILES | C=C(C)/C=C/C=C(\C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C15H22/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h5-8,15H,1,9-11H2,2-4H3/b6-5+,14-7+/t15-/m0/s1 |
| InChIKey | IKNIELYOBJXLKD-ZATLCOBCSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|