About 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one
3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one (PubChem CID 24764198) has the molecular formula C19H22O3S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one.
Molecular Properties
| Compound Name | 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one |
| PubChem CID | 24764198 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one |
| SMILES | CCSC(CC(=O)c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22O3S/c1-4-23-19(15-7-11-17(22-3)12-8-15)13-18(20)14-5-9-16(21-2)10-6-14/h5-12,19H,4,13H2,1-3H3 |
| InChIKey | USJMRUIENLDLIQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one?
The IUPAC name of 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one (CID 24764198) is 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one.
What is the SMILES notation for 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one?
The canonical SMILES for 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one is CCSC(CC(=O)c1ccc(OC)cc1)c1ccc(OC)cc1.
What is the InChIKey of 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one?
The InChIKey is USJMRUIENLDLIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3S/c1-4-23-19(15-7-11-17(22-3)12-8-15)13-18(20)14-5-9-16(21-2)10-6-14/h5-12,19H,4,13H2,1-3H3.
What are the key properties of 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one?
3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one has a molecular weight of 330.45 g/mol, XLogP of 4.77, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanyl-1,3-bis(4-methoxyphenyl)propan-1-one is sourced from PubChem (CID 24764198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).