About 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide
5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide (PubChem CID 24764256) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide.
Molecular Properties
| Compound Name | 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide |
| PubChem CID | 24764256 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide |
| SMILES | Cc1cn(Cc2ccc(CCCCC(N)=O)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H21N3O3/c1-12-10-20(17(23)19-16(12)22)11-14-8-6-13(7-9-14)4-2-3-5-15(18)21/h6-10H,2-5,11H2,1H3,(H2,18,21)(H,19,22,23) |
| InChIKey | BRDBMYGTVZPMJF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide?
The IUPAC name of 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide (CID 24764256) is 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide.
What is the SMILES notation for 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide?
The canonical SMILES for 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide is Cc1cn(Cc2ccc(CCCCC(N)=O)cc2)c(=O)[nH]c1=O.
What is the InChIKey of 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide?
The InChIKey is BRDBMYGTVZPMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-12-10-20(17(23)19-16(12)22)11-14-8-6-13(7-9-14)4-2-3-5-15(18)21/h6-10H,2-5,11H2,1H3,(H2,18,21)(H,19,22,23).
What are the key properties of 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide?
5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide has a molecular weight of 315.37 g/mol, XLogP of 1.09, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]pentanamide is sourced from PubChem (CID 24764256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).