C18H14N2O2 — CID 24764365
2,8-dimethyl-5,11-dihydroquinolino[3,2-b]quinoline-6,12-dione (PubChem CID 24764365) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2,8-dimethyl-5,11-dihydroquinolino[3,2-b]quinoline-6,12-dione.
| Compound Name | 2,8-dimethyl-5,11-dihydroquinolino[3,2-b]quinoline-6,12-dione |
|---|---|
| PubChem CID | 24764365 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2,8-dimethyl-5,11-dihydroquinolino[3,2-b]quinoline-6,12-dione |
| SMILES | Cc1ccc2[nH]c3c(=O)c4cc(C)ccc4[nH]c3c(=O)c2c1 |
| InChI | InChI=1S/C18H14N2O2/c1-9-3-5-13-11(7-9)17(21)15-16(19-13)18(22)12-8-10(2)4-6-14(12)20-15/h3-8H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | DYZKCYLBTJAPFG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|