C29H48O5Si — CID 24764393
ethyl 2-[(1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(5R)-5-phenylmethoxyhexyl]cyclohexyl]acetate (PubChem CID 24764393) has the molecular formula C29H48O5Si and a molecular weight of 504.78 g/mol. Its IUPAC name is ethyl 2-[(1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(5R)-5-phenylmethoxyhexyl]cyclohexyl]acetate.
| Compound Name | ethyl 2-[(1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(5R)-5-phenylmethoxyhexyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 24764393 |
| Molecular Formula | C29H48O5Si |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | ethyl 2-[(1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-[(5R)-5-phenylmethoxyhexyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)[C@@H]1CCCC[C@@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C29H48O5Si/c1-8-32-28(31)20-25-24(26(30)18-19-27(25)34-35(6,7)29(3,4)5)17-13-12-14-22(2)33-21-23-15-10-9-11-16-23/h9-11,15-16,22,24-25,27H,8,12-14,17-21H2,1-7H3/t22-,24-,25-,27+/m1/s1 |
| InChIKey | IGICXTDBDXCGIR-YUHKXCSQSA-N |
| XLogP | 7.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|