C11H10F6N2O5S — CID 24765647
4-nitro-N-[4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide (PubChem CID 24765647) has the molecular formula C11H10F6N2O5S and a molecular weight of 396.27 g/mol. Its IUPAC name is 4-nitro-N-[4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24765647 |
| Molecular Formula | C11H10F6N2O5S |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 4-nitro-N-[4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NC(CO)C(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F6N2O5S/c12-10(13,14)9(11(15,16)17)8(5-20)18-25(23,24)7-3-1-6(2-4-7)19(21)22/h1-4,8-9,18,20H,5H2 |
| InChIKey | CCNXXXGSBJZDNU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|