C21H23F4N3O2 — CID 24765959
2-[4-[(3S)-3-fluoropyrrolidin-1-yl]phenyl]-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide (PubChem CID 24765959) has the molecular formula C21H23F4N3O2 and a molecular weight of 425.43 g/mol. Its IUPAC name is 2-[4-[(3S)-3-fluoropyrrolidin-1-yl]phenyl]-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide.
| Compound Name | 2-[4-[(3S)-3-fluoropyrrolidin-1-yl]phenyl]-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 24765959 |
| Molecular Formula | C21H23F4N3O2 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-[4-[(3S)-3-fluoropyrrolidin-1-yl]phenyl]-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1ccc(N2CC[C@H](F)C2)cc1)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C21H23F4N3O2/c1-14(19-7-6-18(11-26-19)30-13-21(23,24)25)27-20(29)10-15-2-4-17(5-3-15)28-9-8-16(22)12-28/h2-7,11,14,16H,8-10,12-13H2,1H3,(H,27,29)/t14-,16+/m1/s1 |
| InChIKey | KFOJVPUYEZVTSM-ZBFHGGJFSA-N |
| XLogP | 3.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|