C29H24N2O3 — CID 24766470
6,6-dimethyl-2-nitro-5a-(4-phenylphenyl)-12H-indolo[2,1-b][1,3]benzoxazine (PubChem CID 24766470) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is 6,6-dimethyl-2-nitro-5a-(4-phenylphenyl)-12H-indolo[2,1-b][1,3]benzoxazine.
| Compound Name | 6,6-dimethyl-2-nitro-5a-(4-phenylphenyl)-12H-indolo[2,1-b][1,3]benzoxazine |
|---|---|
| PubChem CID | 24766470 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 6,6-dimethyl-2-nitro-5a-(4-phenylphenyl)-12H-indolo[2,1-b][1,3]benzoxazine |
| SMILES | CC1(C)c2ccccc2N2Cc3cc([N+](=O)[O-])ccc3OC21c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N2O3/c1-28(2)25-10-6-7-11-26(25)30-19-22-18-24(31(32)33)16-17-27(22)34-29(28,30)23-14-12-21(13-15-23)20-8-4-3-5-9-20/h3-18H,19H2,1-2H3 |
| InChIKey | LGFFLNXHMXZSSX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|