C31H26N2O3 — CID 24766472
6,6-dimethyl-2-nitro-5a-[(E)-2-(4-phenylphenyl)ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine (PubChem CID 24766472) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is 6,6-dimethyl-2-nitro-5a-[(E)-2-(4-phenylphenyl)ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine.
| Compound Name | 6,6-dimethyl-2-nitro-5a-[(E)-2-(4-phenylphenyl)ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine |
|---|---|
| PubChem CID | 24766472 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 6,6-dimethyl-2-nitro-5a-[(E)-2-(4-phenylphenyl)ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine |
| SMILES | CC1(C)c2ccccc2N2Cc3cc([N+](=O)[O-])ccc3OC21/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2O3/c1-30(2)27-10-6-7-11-28(27)32-21-25-20-26(33(34)35)16-17-29(25)36-31(30,32)19-18-22-12-14-24(15-13-22)23-8-4-3-5-9-23/h3-20H,21H2,1-2H3/b19-18+ |
| InChIKey | PHRBBMXXWQPLIL-VHEBQXMUSA-N |
| XLogP | 7.36 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|