C33H28N2O3 — CID 24766571
6,6-dimethyl-2-nitro-5a-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine (PubChem CID 24766571) has the molecular formula C33H28N2O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is 6,6-dimethyl-2-nitro-5a-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine.
| Compound Name | 6,6-dimethyl-2-nitro-5a-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine |
|---|---|
| PubChem CID | 24766571 |
| Molecular Formula | C33H28N2O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 6,6-dimethyl-2-nitro-5a-[(E)-2-[4-[(E)-2-phenylethenyl]phenyl]ethenyl]-12H-indolo[2,1-b][1,3]benzoxazine |
| SMILES | CC1(C)c2ccccc2N2Cc3cc([N+](=O)[O-])ccc3OC21/C=C/c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C33H28N2O3/c1-32(2)29-10-6-7-11-30(29)34-23-27-22-28(35(36)37)18-19-31(27)38-33(32,34)21-20-26-16-14-25(15-17-26)13-12-24-8-4-3-5-9-24/h3-22H,23H2,1-2H3/b13-12+,21-20+ |
| InChIKey | MZEYJPIXXMCGKJ-TUHJNPCUSA-N |
| XLogP | 7.87 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|