About N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate
N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate (PubChem CID 24766598) has the molecular formula C12H11Cl2N3S
and a molecular weight of 300.21 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate.
Molecular Properties
| Compound Name | N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate |
| PubChem CID | 24766598 |
| Molecular Formula | C12H11Cl2N3S |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate |
| SMILES | Cn1cc[n+](C)c1/C([S-])=N/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3S/c1-16-3-4-17(2)12(16)11(18)15-10-6-8(13)5-9(14)7-10/h3-7H,1-2H3 |
| InChIKey | ADZOKKVMPFEDLL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 21.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate?
The IUPAC name of N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate (CID 24766598) is N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate.
What is the SMILES notation for N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate?
The canonical SMILES for N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate is Cn1cc[n+](C)c1/C([S-])=N/c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate?
The InChIKey is ADZOKKVMPFEDLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N3S/c1-16-3-4-17(2)12(16)11(18)15-10-6-8(13)5-9(14)7-10/h3-7H,1-2H3.
What are the key properties of N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate?
N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate has a molecular weight of 300.21 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichlorophenyl)-1,3-dimethylimidazol-1-ium-2-carboximidothioate is sourced from PubChem (CID 24766598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).