C22H32O4 — CID 24766768
[(Z)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-2-en-4,6-diynyl] acetate (PubChem CID 24766768) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(Z)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-2-en-4,6-diynyl] acetate.
| Compound Name | [(Z)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-2-en-4,6-diynyl] acetate |
|---|---|
| PubChem CID | 24766768 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(Z)-8-[(4R,5R)-5-heptyl-2,2-dimethyl-1,3-dioxolan-4-yl]oct-2-en-4,6-diynyl] acetate |
| SMILES | CCCCCCC[C@H]1OC(C)(C)O[C@@H]1CC#CC#C/C=C\COC(C)=O |
| InChI | InChI=1S/C22H32O4/c1-5-6-7-10-13-16-20-21(26-22(3,4)25-20)17-14-11-8-9-12-15-18-24-19(2)23/h12,15,20-21H,5-7,10,13,16-18H2,1-4H3/b15-12-/t20-,21-/m1/s1 |
| InChIKey | UJFGXKBFGKLZDA-VMPLDSKBSA-N |
| XLogP | 4.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|